C20H19F2N3O — CID 110349610
2-(4-fluorophenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]acetonitrile (PubChem CID 110349610) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-(4-fluorophenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 110349610 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-(4-fluorophenyl)-2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]acetonitrile |
| SMILES | N#CC(c1ccc(F)cc1)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H19F2N3O/c21-17-5-1-15(2-6-17)13-20(26)25-11-9-24(10-12-25)19(14-23)16-3-7-18(22)8-4-16/h1-8,19H,9-13H2 |
| InChIKey | XTYDAUIJFLTPSM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |