C10H12FNO2S2 — CID 122332182
3-[(4-fluorophenyl)methylsulfonyl]-1,3-thiazolidine (PubChem CID 122332182) has the molecular formula C10H12FNO2S2 and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylsulfonyl]-1,3-thiazolidine.
| Compound Name | 3-[(4-fluorophenyl)methylsulfonyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 122332182 |
| Molecular Formula | C10H12FNO2S2 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 3-[(4-fluorophenyl)methylsulfonyl]-1,3-thiazolidine |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N1CCSC1 |
| InChI | InChI=1S/C10H12FNO2S2/c11-10-3-1-9(2-4-10)7-16(13,14)12-5-6-15-8-12/h1-4H,5-8H2 |
| InChIKey | SRPSDTZIBWKOTN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |