C9H15N3S — CID 116939719
piperazin-1-yl(thiophen-2-yl)methanamine (PubChem CID 116939719) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is piperazin-1-yl(thiophen-2-yl)methanamine.
| Compound Name | piperazin-1-yl(thiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 116939719 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | piperazin-1-yl(thiophen-2-yl)methanamine |
| SMILES | NC(c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C9H15N3S/c10-9(8-2-1-7-13-8)12-5-3-11-4-6-12/h1-2,7,9,11H,3-6,10H2 |
| InChIKey | MGGRKLAQJHUZMX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |