C13H22N2S — CID 171309479
1-[(1S)-1-thiophen-2-ylpentyl]piperazine (PubChem CID 171309479) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-[(1S)-1-thiophen-2-ylpentyl]piperazine.
| Compound Name | 1-[(1S)-1-thiophen-2-ylpentyl]piperazine |
|---|---|
| PubChem CID | 171309479 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-[(1S)-1-thiophen-2-ylpentyl]piperazine |
| SMILES | CCCC[C@@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C13H22N2S/c1-2-3-5-12(13-6-4-11-16-13)15-9-7-14-8-10-15/h4,6,11-12,14H,2-3,5,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | RGYFWHBESXJUAA-LBPRGKRZSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |