C12H19Cl2F3N2S — CID 171303977
1-[(1R)-4,4,4-trifluoro-1-thiophen-2-ylbutyl]piperazine;dihydrochloride (PubChem CID 171303977) has the molecular formula C12H19Cl2F3N2S and a molecular weight of 351.27 g/mol. Its IUPAC name is 1-[(1R)-4,4,4-trifluoro-1-thiophen-2-ylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-4,4,4-trifluoro-1-thiophen-2-ylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171303977 |
| Molecular Formula | C12H19Cl2F3N2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[(1R)-4,4,4-trifluoro-1-thiophen-2-ylbutyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CC[C@H](c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C12H17F3N2S.2ClH/c13-12(14,15)4-3-10(11-2-1-9-18-11)17-7-5-16-6-8-17;;/h1-2,9-10,16H,3-8H2;2*1H/t10-;;/m1../s1 |
| InChIKey | GAHGNTGKEUNUDA-YQFADDPSSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |