C13H24Cl2N2S — CID 171308182
1-[(1R)-1-thiophen-2-ylpentyl]piperazine;dihydrochloride (PubChem CID 171308182) has the molecular formula C13H24Cl2N2S and a molecular weight of 311.32 g/mol. Its IUPAC name is 1-[(1R)-1-thiophen-2-ylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-thiophen-2-ylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171308182 |
| Molecular Formula | C13H24Cl2N2S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(1R)-1-thiophen-2-ylpentyl]piperazine;dihydrochloride |
| SMILES | CCCC[C@H](c1cccs1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H22N2S.2ClH/c1-2-3-5-12(13-6-4-11-16-13)15-9-7-14-8-10-15;;/h4,6,11-12,14H,2-3,5,7-10H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | PVXWBCXEGWZKEO-CURYUGHLSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |