C14H25N3S — CID 83979379
N,N-diethyl-2-piperazin-1-yl-2-thiophen-2-ylethanamine (PubChem CID 83979379) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is N,N-diethyl-2-piperazin-1-yl-2-thiophen-2-ylethanamine.
| Compound Name | N,N-diethyl-2-piperazin-1-yl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 83979379 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N,N-diethyl-2-piperazin-1-yl-2-thiophen-2-ylethanamine |
| SMILES | CCN(CC)CC(c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C14H25N3S/c1-3-16(4-2)12-13(14-6-5-11-18-14)17-9-7-15-8-10-17/h5-6,11,13,15H,3-4,7-10,12H2,1-2H3 |
| InChIKey | NQBYCQVWUFPZQB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |