C13H15F2N3 — CID 54889244
2-(1,4-diazepan-1-yl)-2-(3,4-difluorophenyl)acetonitrile (PubChem CID 54889244) has the molecular formula C13H15F2N3 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(3,4-difluorophenyl)acetonitrile.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(3,4-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54889244 |
| Molecular Formula | C13H15F2N3 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(3,4-difluorophenyl)acetonitrile |
| SMILES | N#CC(c1ccc(F)c(F)c1)N1CCCNCC1 |
| InChI | InChI=1S/C13H15F2N3/c14-11-3-2-10(8-12(11)15)13(9-16)18-6-1-4-17-5-7-18/h2-3,8,13,17H,1,4-7H2 |
| InChIKey | FQVFOHAMKMCTII-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |