C16H30Cl2N2S — CID 171311160
1-[(1R)-1-(5-ethylthiophen-2-yl)-4-methylpentyl]piperazine;dihydrochloride (PubChem CID 171311160) has the molecular formula C16H30Cl2N2S and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-[(1R)-1-(5-ethylthiophen-2-yl)-4-methylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(5-ethylthiophen-2-yl)-4-methylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171311160 |
| Molecular Formula | C16H30Cl2N2S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(1R)-1-(5-ethylthiophen-2-yl)-4-methylpentyl]piperazine;dihydrochloride |
| SMILES | CCc1ccc([C@@H](CCC(C)C)N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C16H28N2S.2ClH/c1-4-14-6-8-16(19-14)15(7-5-13(2)3)18-11-9-17-10-12-18;;/h6,8,13,15,17H,4-5,7,9-12H2,1-3H3;2*1H/t15-;;/m1../s1 |
| InChIKey | SMHBADUEPYBMQK-QCUBGVIVSA-N |
| XLogP | 4.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |