C15H28Cl2N2S — CID 171281368
1-[(1S)-1-(5-ethylthiophen-2-yl)-3-methylbutyl]piperazine;dihydrochloride (PubChem CID 171281368) has the molecular formula C15H28Cl2N2S and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-[(1S)-1-(5-ethylthiophen-2-yl)-3-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(5-ethylthiophen-2-yl)-3-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281368 |
| Molecular Formula | C15H28Cl2N2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(1S)-1-(5-ethylthiophen-2-yl)-3-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCc1ccc([C@H](CC(C)C)N2CCNCC2)s1.Cl.Cl |
| InChI | InChI=1S/C15H26N2S.2ClH/c1-4-13-5-6-15(18-13)14(11-12(2)3)17-9-7-16-8-10-17;;/h5-6,12,14,16H,4,7-11H2,1-3H3;2*1H/t14-;;/m0../s1 |
| InChIKey | DTZYDKATZCEKDQ-UTLKBRERSA-N |
| XLogP | 4.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |