C16H28Cl2N2 — CID 171305477
1-[(1S)-2-methyl-1-(2-methylphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171305477) has the molecular formula C16H28Cl2N2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[(1S)-2-methyl-1-(2-methylphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-methyl-1-(2-methylphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305477 |
| Molecular Formula | C16H28Cl2N2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[(1S)-2-methyl-1-(2-methylphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1ccccc1C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H26N2.2ClH/c1-4-13(2)16(18-11-9-17-10-12-18)15-8-6-5-7-14(15)3;;/h5-8,13,16-17H,4,9-12H2,1-3H3;2*1H/t13?,16-;;/m0../s1 |
| InChIKey | JGKFGJSCVWUOIP-DPKXBHMFSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |