C15H23IN2 — CID 171304736
1-[(1R)-1-(2-iodophenyl)-2-methylbutyl]piperazine (PubChem CID 171304736) has the molecular formula C15H23IN2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-[(1R)-1-(2-iodophenyl)-2-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-(2-iodophenyl)-2-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171304736 |
| Molecular Formula | C15H23IN2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[(1R)-1-(2-iodophenyl)-2-methylbutyl]piperazine |
| SMILES | CCC(C)[C@H](c1ccccc1I)N1CCNCC1 |
| InChI | InChI=1S/C15H23IN2/c1-3-12(2)15(18-10-8-17-9-11-18)13-6-4-5-7-14(13)16/h4-7,12,15,17H,3,8-11H2,1-2H3/t12?,15-/m1/s1 |
| InChIKey | JAIBFXJRHOSNEM-WPZCJLIBSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|