C18H29Cl2N3 — CID 171305371
1-methyl-3-[(1S)-2-methyl-1-piperazin-1-ylbutyl]indole;dihydrochloride (PubChem CID 171305371) has the molecular formula C18H29Cl2N3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-methyl-3-[(1S)-2-methyl-1-piperazin-1-ylbutyl]indole;dihydrochloride.
| Compound Name | 1-methyl-3-[(1S)-2-methyl-1-piperazin-1-ylbutyl]indole;dihydrochloride |
|---|---|
| PubChem CID | 171305371 |
| Molecular Formula | C18H29Cl2N3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-methyl-3-[(1S)-2-methyl-1-piperazin-1-ylbutyl]indole;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1cn(C)c2ccccc12)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H27N3.2ClH/c1-4-14(2)18(21-11-9-19-10-12-21)16-13-20(3)17-8-6-5-7-15(16)17;;/h5-8,13-14,18-19H,4,9-12H2,1-3H3;2*1H/t14?,18-;;/m0../s1 |
| InChIKey | RPRWEJGOPUJPKA-JLSNGUJASA-N |
| XLogP | 4.01 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |