C19H29Cl2N3 — CID 171278740
3-[(S)-cyclopentyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride (PubChem CID 171278740) has the molecular formula C19H29Cl2N3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 3-[(S)-cyclopentyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride.
| Compound Name | 3-[(S)-cyclopentyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride |
|---|---|
| PubChem CID | 171278740 |
| Molecular Formula | C19H29Cl2N3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-[(S)-cyclopentyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc([C@H](C2CCCC2)N2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C19H27N3.2ClH/c1-21-14-17(16-8-4-5-9-18(16)21)19(15-6-2-3-7-15)22-12-10-20-11-13-22;;/h4-5,8-9,14-15,19-20H,2-3,6-7,10-13H2,1H3;2*1H/t19-;;/m0../s1 |
| InChIKey | YZBJTIFGAKYDDC-TXEPZDRESA-N |
| XLogP | 4.16 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |