C16H22N2 — CID 10633946
2-cyclopentyl-2-(1-methylindol-3-yl)ethanamine (PubChem CID 10633946) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-cyclopentyl-2-(1-methylindol-3-yl)ethanamine.
| Compound Name | 2-cyclopentyl-2-(1-methylindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 10633946 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-cyclopentyl-2-(1-methylindol-3-yl)ethanamine |
| SMILES | Cn1cc(C(CN)C2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C16H22N2/c1-18-11-15(13-8-4-5-9-16(13)18)14(10-17)12-6-2-3-7-12/h4-5,8-9,11-12,14H,2-3,6-7,10,17H2,1H3 |
| InChIKey | WFFHKKXMYBAIBQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |