C20H31Cl2N3 — CID 171278742
3-[(S)-cyclohexyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride (PubChem CID 171278742) has the molecular formula C20H31Cl2N3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 3-[(S)-cyclohexyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride.
| Compound Name | 3-[(S)-cyclohexyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride |
|---|---|
| PubChem CID | 171278742 |
| Molecular Formula | C20H31Cl2N3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[(S)-cyclohexyl(piperazin-1-yl)methyl]-1-methylindole;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc([C@H](C2CCCCC2)N2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C20H29N3.2ClH/c1-22-15-18(17-9-5-6-10-19(17)22)20(16-7-3-2-4-8-16)23-13-11-21-12-14-23;;/h5-6,9-10,15-16,20-21H,2-4,7-8,11-14H2,1H3;2*1H/t20-;;/m0../s1 |
| InChIKey | RICQFBXBVFEBBO-FJSYBICCSA-N |
| XLogP | 4.55 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |