C24H30Cl2N2 — CID 171272083
1-[(S)-anthracen-9-yl(cyclopentyl)methyl]piperazine;dihydrochloride (PubChem CID 171272083) has the molecular formula C24H30Cl2N2 and a molecular weight of 417.42 g/mol. Its IUPAC name is 1-[(S)-anthracen-9-yl(cyclopentyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-anthracen-9-yl(cyclopentyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171272083 |
| Molecular Formula | C24H30Cl2N2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[(S)-anthracen-9-yl(cyclopentyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c([C@H](C3CCCC3)N3CCNCC3)c3ccccc3cc2c1 |
| InChI | InChI=1S/C24H28N2.2ClH/c1-2-8-18(7-1)24(26-15-13-25-14-16-26)23-21-11-5-3-9-19(21)17-20-10-4-6-12-22(20)23;;/h3-6,9-12,17-18,24-25H,1-2,7-8,13-16H2;2*1H/t24-;;/m0../s1 |
| InChIKey | OCIXUXDQRRQHSA-ASMAMLKCSA-N |
| XLogP | 5.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|