C26H30Cl2N2 — CID 171284515
1-[(S)-cyclopentyl(pyren-1-yl)methyl]piperazine;dihydrochloride (PubChem CID 171284515) has the molecular formula C26H30Cl2N2 and a molecular weight of 441.45 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl(pyren-1-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl(pyren-1-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171284515 |
| Molecular Formula | C26H30Cl2N2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[(S)-cyclopentyl(pyren-1-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1cc2ccc3ccc([C@H](C4CCCC4)N4CCNCC4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C26H28N2.2ClH/c1-2-5-21(4-1)26(28-16-14-27-15-17-28)23-13-11-20-9-8-18-6-3-7-19-10-12-22(23)25(20)24(18)19;;/h3,6-13,21,26-27H,1-2,4-5,14-17H2;2*1H/t26-;;/m0../s1 |
| InChIKey | NGNVTPLZWRXAIY-ROPHLPQBSA-N |
| XLogP | 6.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|