C20H29Cl2N3 — CID 171284597
2-[(S)-cyclohexyl(piperazin-1-yl)methyl]quinoline;dihydrochloride (PubChem CID 171284597) has the molecular formula C20H29Cl2N3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]quinoline;dihydrochloride.
| Compound Name | 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]quinoline;dihydrochloride |
|---|---|
| PubChem CID | 171284597 |
| Molecular Formula | C20H29Cl2N3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[(S)-cyclohexyl(piperazin-1-yl)methyl]quinoline;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2nc([C@H](C3CCCCC3)N3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C20H27N3.2ClH/c1-2-7-17(8-3-1)20(23-14-12-21-13-15-23)19-11-10-16-6-4-5-9-18(16)22-19;;/h4-6,9-11,17,20-21H,1-3,7-8,12-15H2;2*1H/t20-;;/m0../s1 |
| InChIKey | QNGIGTJMCZMDGN-FJSYBICCSA-N |
| XLogP | 4.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |