C17H25Cl2N3 — CID 171284605
2-[(1S)-1-piperazin-1-ylbutyl]quinoline;dihydrochloride (PubChem CID 171284605) has the molecular formula C17H25Cl2N3 and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-[(1S)-1-piperazin-1-ylbutyl]quinoline;dihydrochloride.
| Compound Name | 2-[(1S)-1-piperazin-1-ylbutyl]quinoline;dihydrochloride |
|---|---|
| PubChem CID | 171284605 |
| Molecular Formula | C17H25Cl2N3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[(1S)-1-piperazin-1-ylbutyl]quinoline;dihydrochloride |
| SMILES | CCC[C@@H](c1ccc2ccccc2n1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H23N3.2ClH/c1-2-5-17(20-12-10-18-11-13-20)16-9-8-14-6-3-4-7-15(14)19-16;;/h3-4,6-9,17-18H,2,5,10-13H2,1H3;2*1H/t17-;;/m0../s1 |
| InChIKey | LAWXOPOJQIMDGJ-RMRYJAPISA-N |
| XLogP | 3.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |