C16H22Cl3N3 — CID 171296088
2-chloro-3-[(1R)-1-piperazin-1-ylpropyl]quinoline;dihydrochloride (PubChem CID 171296088) has the molecular formula C16H22Cl3N3 and a molecular weight of 362.73 g/mol. Its IUPAC name is 2-chloro-3-[(1R)-1-piperazin-1-ylpropyl]quinoline;dihydrochloride.
| Compound Name | 2-chloro-3-[(1R)-1-piperazin-1-ylpropyl]quinoline;dihydrochloride |
|---|---|
| PubChem CID | 171296088 |
| Molecular Formula | C16H22Cl3N3 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-chloro-3-[(1R)-1-piperazin-1-ylpropyl]quinoline;dihydrochloride |
| SMILES | CC[C@H](c1cc2ccccc2nc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H20ClN3.2ClH/c1-2-15(20-9-7-18-8-10-20)13-11-12-5-3-4-6-14(12)19-16(13)17;;/h3-6,11,15,18H,2,7-10H2,1H3;2*1H/t15-;;/m1../s1 |
| InChIKey | APTRKLHUTARQKX-QCUBGVIVSA-N |
| XLogP | 4.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|