C19H26ClN3 — CID 171311279
2-chloro-3-[(1R)-4-methyl-1-piperazin-1-ylpentyl]quinoline (PubChem CID 171311279) has the molecular formula C19H26ClN3 and a molecular weight of 331.89 g/mol. Its IUPAC name is 2-chloro-3-[(1R)-4-methyl-1-piperazin-1-ylpentyl]quinoline.
| Compound Name | 2-chloro-3-[(1R)-4-methyl-1-piperazin-1-ylpentyl]quinoline |
|---|---|
| PubChem CID | 171311279 |
| Molecular Formula | C19H26ClN3 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-chloro-3-[(1R)-4-methyl-1-piperazin-1-ylpentyl]quinoline |
| SMILES | CC(C)CC[C@H](c1cc2ccccc2nc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C19H26ClN3/c1-14(2)7-8-18(23-11-9-21-10-12-23)16-13-15-5-3-4-6-17(15)22-19(16)20/h3-6,13-14,18,21H,7-12H2,1-2H3/t18-/m1/s1 |
| InChIKey | ZWWSQRMXQGCVER-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|