C16H17ClF3N3 — CID 171303150
2-chloro-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]quinoline (PubChem CID 171303150) has the molecular formula C16H17ClF3N3 and a molecular weight of 343.78 g/mol. Its IUPAC name is 2-chloro-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]quinoline.
| Compound Name | 2-chloro-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]quinoline |
|---|---|
| PubChem CID | 171303150 |
| Molecular Formula | C16H17ClF3N3 |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-chloro-3-[(1S)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]quinoline |
| SMILES | FC(F)(F)C[C@@H](c1cc2ccccc2nc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H17ClF3N3/c17-15-12(9-11-3-1-2-4-13(11)22-15)14(10-16(18,19)20)23-7-5-21-6-8-23/h1-4,9,14,21H,5-8,10H2/t14-/m0/s1 |
| InChIKey | YPAHQDYEWGUXOH-AWEZNQCLSA-N |
| XLogP | 3.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|