C19H26ClN3 — CID 171308399
2-chloro-3-[(1R)-1-piperazin-1-ylhexyl]quinoline (PubChem CID 171308399) has the molecular formula C19H26ClN3 and a molecular weight of 331.89 g/mol. Its IUPAC name is 2-chloro-3-[(1R)-1-piperazin-1-ylhexyl]quinoline.
| Compound Name | 2-chloro-3-[(1R)-1-piperazin-1-ylhexyl]quinoline |
|---|---|
| PubChem CID | 171308399 |
| Molecular Formula | C19H26ClN3 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-chloro-3-[(1R)-1-piperazin-1-ylhexyl]quinoline |
| SMILES | CCCCC[C@H](c1cc2ccccc2nc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C19H26ClN3/c1-2-3-4-9-18(23-12-10-21-11-13-23)16-14-15-7-5-6-8-17(15)22-19(16)20/h5-8,14,18,21H,2-4,9-13H2,1H3/t18-/m1/s1 |
| InChIKey | FNYKGVFIIFCZQZ-GOSISDBHSA-N |
| XLogP | 4.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|