C16H27Cl3N2 — CID 171310400
1-[(1S)-1-(2-chlorophenyl)-4-methylpentyl]piperazine;dihydrochloride (PubChem CID 171310400) has the molecular formula C16H27Cl3N2 and a molecular weight of 353.77 g/mol. Its IUPAC name is 1-[(1S)-1-(2-chlorophenyl)-4-methylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-chlorophenyl)-4-methylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171310400 |
| Molecular Formula | C16H27Cl3N2 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(1S)-1-(2-chlorophenyl)-4-methylpentyl]piperazine;dihydrochloride |
| SMILES | CC(C)CC[C@@H](c1ccccc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H25ClN2.2ClH/c1-13(2)7-8-16(19-11-9-18-10-12-19)14-5-3-4-6-15(14)17;;/h3-6,13,16,18H,7-12H2,1-2H3;2*1H/t16-;;/m0../s1 |
| InChIKey | ZEBIJENUHACTHL-SQKCAUCHSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |