C15H25Cl4N3 — CID 171310090
1-[(1S)-1-(2,6-dichloro-3-pyridinyl)-4-methylpentyl]piperazine;dihydrochloride (PubChem CID 171310090) has the molecular formula C15H25Cl4N3 and a molecular weight of 389.20 g/mol. Its IUPAC name is 1-[(1S)-1-(2,6-dichloro-3-pyridinyl)-4-methylpentyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,6-dichloro-3-pyridinyl)-4-methylpentyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171310090 |
| Molecular Formula | C15H25Cl4N3 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-[(1S)-1-(2,6-dichloro-3-pyridinyl)-4-methylpentyl]piperazine;dihydrochloride |
| SMILES | CC(C)CC[C@@H](c1ccc(Cl)nc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H23Cl2N3.2ClH/c1-11(2)3-5-13(20-9-7-18-8-10-20)12-4-6-14(16)19-15(12)17;;/h4,6,11,13,18H,3,5,7-10H2,1-2H3;2*1H/t13-;;/m0../s1 |
| InChIKey | HYAOUQROXRAVDQ-GXKRWWSZSA-N |
| XLogP | 4.61 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|