C11H15Cl2N3 — CID 131439638
1-[(1R)-1-(2,6-dichloro-3-pyridinyl)ethyl]piperazine (PubChem CID 131439638) has the molecular formula C11H15Cl2N3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)ethyl]piperazine |
|---|---|
| PubChem CID | 131439638 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)ethyl]piperazine |
| SMILES | C[C@H](c1ccc(Cl)nc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C11H15Cl2N3/c1-8(16-6-4-14-5-7-16)9-2-3-10(12)15-11(9)13/h2-3,8,14H,4-7H2,1H3/t8-/m1/s1 |
| InChIKey | ZFLNNHUZODUSRC-MRVPVSSYSA-N |
| XLogP | 2.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|