C13H21Cl4N3 — CID 171289236
1-[(1R)-1-(2,6-dichloro-3-pyridinyl)butyl]piperazine;dihydrochloride (PubChem CID 171289236) has the molecular formula C13H21Cl4N3 and a molecular weight of 361.14 g/mol. Its IUPAC name is 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289236 |
| Molecular Formula | C13H21Cl4N3 |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[(1R)-1-(2,6-dichloro-3-pyridinyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1ccc(Cl)nc1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C13H19Cl2N3.2ClH/c1-2-3-11(18-8-6-16-7-9-18)10-4-5-12(14)17-13(10)15;;/h4-5,11,16H,2-3,6-9H2,1H3;2*1H/t11-;;/m1../s1 |
| InChIKey | IAPDQXOHROOGQR-NVJADKKVSA-N |
| XLogP | 3.98 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|