C14H22BrCl3N2O — CID 171300783
2-bromo-3-chloro-6-[(1R)-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171300783) has the molecular formula C14H22BrCl3N2O and a molecular weight of 420.61 g/mol. Its IUPAC name is 2-bromo-3-chloro-6-[(1R)-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 2-bromo-3-chloro-6-[(1R)-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171300783 |
| Molecular Formula | C14H22BrCl3N2O |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 2-bromo-3-chloro-6-[(1R)-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | CCC[C@H](c1ccc(Cl)c(Br)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H20BrClN2O.2ClH/c1-2-3-12(18-8-6-17-7-9-18)10-4-5-11(16)13(15)14(10)19;;/h4-5,12,17,19H,2-3,6-9H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | SXRDUPVSWBQAGX-CURYUGHLSA-N |
| XLogP | 4.40 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|