C14H20BrClN2O — CID 171297703
3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylbutyl]phenol (PubChem CID 171297703) has the molecular formula C14H20BrClN2O and a molecular weight of 347.68 g/mol. Its IUPAC name is 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171297703 |
| Molecular Formula | C14H20BrClN2O |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylbutyl]phenol |
| SMILES | CCC[C@@H](c1c(Br)ccc(Cl)c1O)N1CCNCC1 |
| InChI | InChI=1S/C14H20BrClN2O/c1-2-3-12(18-8-6-17-7-9-18)13-10(15)4-5-11(16)14(13)19/h4-5,12,17,19H,2-3,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | OCXDRCJYKMUHST-LBPRGKRZSA-N |
| XLogP | 3.55 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|