C15H22BrCl3N2O — CID 171297712
3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride (PubChem CID 171297712) has the molecular formula C15H22BrCl3N2O and a molecular weight of 432.62 g/mol. Its IUPAC name is 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride.
| Compound Name | 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171297712 |
| Molecular Formula | C15H22BrCl3N2O |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | 3-bromo-6-chloro-2-[(1S)-1-piperazin-1-ylpent-4-enyl]phenol;dihydrochloride |
| SMILES | C=CCC[C@@H](c1c(Br)ccc(Cl)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H20BrClN2O.2ClH/c1-2-3-4-13(19-9-7-18-8-10-19)14-11(16)5-6-12(17)15(14)20;;/h2,5-6,13,18,20H,1,3-4,7-10H2;2*1H/t13-;;/m0../s1 |
| InChIKey | UJGZKEOQOAHFQF-GXKRWWSZSA-N |
| XLogP | 4.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|