C15H19Cl3N2 — CID 171282007
1-[(1S)-1-(2,3,6-trichlorophenyl)pent-4-enyl]piperazine (PubChem CID 171282007) has the molecular formula C15H19Cl3N2 and a molecular weight of 333.69 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3,6-trichlorophenyl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(2,3,6-trichlorophenyl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171282007 |
| Molecular Formula | C15H19Cl3N2 |
| Molecular Weight | 333.69 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-[(1S)-1-(2,3,6-trichlorophenyl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@@H](c1c(Cl)ccc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C15H19Cl3N2/c1-2-3-4-13(20-9-7-19-8-10-20)14-11(16)5-6-12(17)15(14)18/h2,5-6,13,19H,1,3-4,7-10H2/t13-/m0/s1 |
| InChIKey | CHCHQDBKMPLIDC-ZDUSSCGKSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|