C14H17Cl4F3N2 — CID 171167220
1-[(1S)-4,4,4-trifluoro-1-(2,3,6-trichlorophenyl)butyl]piperazine;hydrochloride (PubChem CID 171167220) has the molecular formula C14H17Cl4F3N2 and a molecular weight of 412.11 g/mol. Its IUPAC name is 1-[(1S)-4,4,4-trifluoro-1-(2,3,6-trichlorophenyl)butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-4,4,4-trifluoro-1-(2,3,6-trichlorophenyl)butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167220 |
| Molecular Formula | C14H17Cl4F3N2 |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-[(1S)-4,4,4-trifluoro-1-(2,3,6-trichlorophenyl)butyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)CC[C@@H](c1c(Cl)ccc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C14H16Cl3F3N2.ClH/c15-9-1-2-10(16)13(17)12(9)11(3-4-14(18,19)20)22-7-5-21-6-8-22;/h1-2,11,21H,3-8H2;1H/t11-;/m0./s1 |
| InChIKey | LHCXHXJFSAMPGU-MERQFXBCSA-N |
| XLogP | 5.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|