C13H14Cl3N3 — CID 171307072
(3R)-3-piperazin-1-yl-3-(2,3,6-trichlorophenyl)propanenitrile (PubChem CID 171307072) has the molecular formula C13H14Cl3N3 and a molecular weight of 318.64 g/mol. Its IUPAC name is (3R)-3-piperazin-1-yl-3-(2,3,6-trichlorophenyl)propanenitrile.
| Compound Name | (3R)-3-piperazin-1-yl-3-(2,3,6-trichlorophenyl)propanenitrile |
|---|---|
| PubChem CID | 171307072 |
| Molecular Formula | C13H14Cl3N3 |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (3R)-3-piperazin-1-yl-3-(2,3,6-trichlorophenyl)propanenitrile |
| SMILES | N#CC[C@H](c1c(Cl)ccc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H14Cl3N3/c14-9-1-2-10(15)13(16)12(9)11(3-4-17)19-7-5-18-6-8-19/h1-2,11,18H,3,5-8H2/t11-/m1/s1 |
| InChIKey | ZTGCQZWYAIJGKR-LLVKDONJSA-N |
| XLogP | 3.51 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|