C12H15Cl5N4 — CID 171306055
(3S)-3-piperazin-1-yl-3-(2,3,5-trichloro-4-pyridinyl)propanenitrile;dihydrochloride (PubChem CID 171306055) has the molecular formula C12H15Cl5N4 and a molecular weight of 392.55 g/mol. Its IUPAC name is (3S)-3-piperazin-1-yl-3-(2,3,5-trichloro-4-pyridinyl)propanenitrile;dihydrochloride.
| Compound Name | (3S)-3-piperazin-1-yl-3-(2,3,5-trichloro-4-pyridinyl)propanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306055 |
| Molecular Formula | C12H15Cl5N4 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | (3S)-3-piperazin-1-yl-3-(2,3,5-trichloro-4-pyridinyl)propanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@@H](c1c(Cl)cnc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C12H13Cl3N4.2ClH/c13-8-7-18-12(15)11(14)10(8)9(1-2-16)19-5-3-17-4-6-19;;/h7,9,17H,1,3-6H2;2*1H/t9-;;/m0../s1 |
| InChIKey | ABQWEVWRUBLDIF-WWPIYYJJSA-N |
| XLogP | 3.75 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|