C13H15Cl2N3 — CID 171305748
(3S)-3-(2,6-dichlorophenyl)-3-piperazin-1-ylpropanenitrile (PubChem CID 171305748) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is (3S)-3-(2,6-dichlorophenyl)-3-piperazin-1-ylpropanenitrile.
| Compound Name | (3S)-3-(2,6-dichlorophenyl)-3-piperazin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 171305748 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (3S)-3-(2,6-dichlorophenyl)-3-piperazin-1-ylpropanenitrile |
| SMILES | N#CC[C@@H](c1c(Cl)cccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15Cl2N3/c14-10-2-1-3-11(15)13(10)12(4-5-16)18-8-6-17-7-9-18/h1-3,12,17H,4,6-9H2/t12-/m0/s1 |
| InChIKey | UFKKNNPYNCNKBN-LBPRGKRZSA-N |
| XLogP | 2.85 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |