C14H19Cl3FN3 — CID 171306948
(3R)-3-(6-chloro-2-fluoro-3-methylphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306948) has the molecular formula C14H19Cl3FN3 and a molecular weight of 354.68 g/mol. Its IUPAC name is (3R)-3-(6-chloro-2-fluoro-3-methylphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(6-chloro-2-fluoro-3-methylphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306948 |
| Molecular Formula | C14H19Cl3FN3 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (3R)-3-(6-chloro-2-fluoro-3-methylphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cc1ccc(Cl)c([C@@H](CC#N)N2CCNCC2)c1F.Cl.Cl |
| InChI | InChI=1S/C14H17ClFN3.2ClH/c1-10-2-3-11(15)13(14(10)16)12(4-5-17)19-8-6-18-7-9-19;;/h2-3,12,18H,4,6-9H2,1H3;2*1H/t12-;;/m1../s1 |
| InChIKey | IGNRVEFEADGMSR-CURYUGHLSA-N |
| XLogP | 3.49 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |