C13H18Cl3FN2 — CID 171167530
1-[(1S)-1-(3,6-dichloro-2-fluorophenyl)propyl]piperazine;hydrochloride (PubChem CID 171167530) has the molecular formula C13H18Cl3FN2 and a molecular weight of 327.66 g/mol. Its IUPAC name is 1-[(1S)-1-(3,6-dichloro-2-fluorophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-(3,6-dichloro-2-fluorophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167530 |
| Molecular Formula | C13H18Cl3FN2 |
| Molecular Weight | 327.66 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-[(1S)-1-(3,6-dichloro-2-fluorophenyl)propyl]piperazine;hydrochloride |
| SMILES | CC[C@@H](c1c(Cl)ccc(Cl)c1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H17Cl2FN2.ClH/c1-2-11(18-7-5-17-6-8-18)12-9(14)3-4-10(15)13(12)16;/h3-4,11,17H,2,5-8H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | UJNNQUAJNCBRMK-MERQFXBCSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|