C13H17Cl4N3O — CID 171307173
(3R)-3-(2,4-dichloro-6-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171307173) has the molecular formula C13H17Cl4N3O and a molecular weight of 373.11 g/mol. Its IUPAC name is (3R)-3-(2,4-dichloro-6-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(2,4-dichloro-6-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171307173 |
| Molecular Formula | C13H17Cl4N3O |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | (3R)-3-(2,4-dichloro-6-hydroxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | Cl.Cl.N#CC[C@H](c1c(O)cc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H15Cl2N3O.2ClH/c14-9-7-10(15)13(12(19)8-9)11(1-2-16)18-5-3-17-4-6-18;;/h7-8,11,17,19H,1,3-6H2;2*1H/t11-;;/m1../s1 |
| InChIKey | KXMGIMFTAJYJQI-NVJADKKVSA-N |
| XLogP | 3.40 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|