C13H17Cl3F2N2O — CID 171177550
3,5-dichloro-2-[(1R)-3,3-difluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride (PubChem CID 171177550) has the molecular formula C13H17Cl3F2N2O and a molecular weight of 361.65 g/mol. Its IUPAC name is 3,5-dichloro-2-[(1R)-3,3-difluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride.
| Compound Name | 3,5-dichloro-2-[(1R)-3,3-difluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171177550 |
| Molecular Formula | C13H17Cl3F2N2O |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3,5-dichloro-2-[(1R)-3,3-difluoro-1-piperazin-1-ylpropyl]phenol;hydrochloride |
| SMILES | Cl.Oc1cc(Cl)cc(Cl)c1[C@@H](CC(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H16Cl2F2N2O.ClH/c14-8-5-9(15)13(11(20)6-8)10(7-12(16)17)19-3-1-18-2-4-19;/h5-6,10,12,18,20H,1-4,7H2;1H/t10-;/m1./s1 |
| InChIKey | RBFBCIINSYFOHX-HNCPQSOCSA-N |
| XLogP | 3.72 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|