C13H16Cl3N3 — CID 171290183
1-[(R)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine (PubChem CID 171290183) has the molecular formula C13H16Cl3N3 and a molecular weight of 320.65 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine |
|---|---|
| PubChem CID | 171290183 |
| Molecular Formula | C13H16Cl3N3 |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 1-[(R)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine |
| SMILES | Clc1cnc(Cl)c(Cl)c1[C@@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C13H16Cl3N3/c14-9-7-18-13(16)11(15)10(9)12(8-1-2-8)19-5-3-17-4-6-19/h7-8,12,17H,1-6H2/t12-/m1/s1 |
| InChIKey | UUURSGZAQJIVAZ-GFCCVEGCSA-N |
| XLogP | 3.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|