C16H22Cl3FN2 — CID 171167632
1-[(S)-cyclopentyl-(2,3-dichloro-6-fluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 171167632) has the molecular formula C16H22Cl3FN2 and a molecular weight of 367.72 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(2,3-dichloro-6-fluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclopentyl-(2,3-dichloro-6-fluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171167632 |
| Molecular Formula | C16H22Cl3FN2 |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-[(S)-cyclopentyl-(2,3-dichloro-6-fluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(Cl)c(Cl)c1[C@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H21Cl2FN2.ClH/c17-12-5-6-13(19)14(15(12)18)16(11-3-1-2-4-11)21-9-7-20-8-10-21;/h5-6,11,16,20H,1-4,7-10H2;1H/t16-;/m0./s1 |
| InChIKey | GXCBQMITACXWHM-NTISSMGPSA-N |
| XLogP | 4.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|