C15H20Cl3N3 — CID 171290187
1-[(R)-cyclopentyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine (PubChem CID 171290187) has the molecular formula C15H20Cl3N3 and a molecular weight of 348.71 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine.
| Compound Name | 1-[(R)-cyclopentyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine |
|---|---|
| PubChem CID | 171290187 |
| Molecular Formula | C15H20Cl3N3 |
| Molecular Weight | 348.71 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-[(R)-cyclopentyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine |
| SMILES | Clc1cnc(Cl)c(Cl)c1[C@@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C15H20Cl3N3/c16-11-9-20-15(18)13(17)12(11)14(10-3-1-2-4-10)21-7-5-19-6-8-21/h9-10,14,19H,1-8H2/t14-/m1/s1 |
| InChIKey | BTNMOSXDNXXIAZ-CQSZACIVSA-N |
| XLogP | 4.18 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|