C14H21ClN2S — CID 171276236
1-[(S)-(3-chlorothiophen-2-yl)-cyclopentylmethyl]piperazine (PubChem CID 171276236) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 1-[(S)-(3-chlorothiophen-2-yl)-cyclopentylmethyl]piperazine.
| Compound Name | 1-[(S)-(3-chlorothiophen-2-yl)-cyclopentylmethyl]piperazine |
|---|---|
| PubChem CID | 171276236 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[(S)-(3-chlorothiophen-2-yl)-cyclopentylmethyl]piperazine |
| SMILES | Clc1ccsc1[C@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C14H21ClN2S/c15-12-5-10-18-14(12)13(11-3-1-2-4-11)17-8-6-16-7-9-17/h5,10-11,13,16H,1-4,6-9H2/t13-/m0/s1 |
| InChIKey | ACEXZANQFVNPKQ-ZDUSSCGKSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |