C13H21Cl3N2S — CID 171276249
1-[(1S)-1-(3-chlorothiophen-2-yl)-2-cyclopropylethyl]piperazine;dihydrochloride (PubChem CID 171276249) has the molecular formula C13H21Cl3N2S and a molecular weight of 343.75 g/mol. Its IUPAC name is 1-[(1S)-1-(3-chlorothiophen-2-yl)-2-cyclopropylethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(3-chlorothiophen-2-yl)-2-cyclopropylethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171276249 |
| Molecular Formula | C13H21Cl3N2S |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-[(1S)-1-(3-chlorothiophen-2-yl)-2-cyclopropylethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccsc1[C@H](CC1CC1)N1CCNCC1 |
| InChI | InChI=1S/C13H19ClN2S.2ClH/c14-11-3-8-17-13(11)12(9-10-1-2-10)16-6-4-15-5-7-16;;/h3,8,10,12,15H,1-2,4-7,9H2;2*1H/t12-;;/m0../s1 |
| InChIKey | IWEARQCXJBNABN-LTCKWSDVSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |