C13H18Cl5N3 — CID 171277559
1-[(S)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine;dihydrochloride (PubChem CID 171277559) has the molecular formula C13H18Cl5N3 and a molecular weight of 393.57 g/mol. Its IUPAC name is 1-[(S)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277559 |
| Molecular Formula | C13H18Cl5N3 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 1-[(S)-cyclopropyl-(2,3,5-trichloro-4-pyridinyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cnc(Cl)c(Cl)c1[C@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C13H16Cl3N3.2ClH/c14-9-7-18-13(16)11(15)10(9)12(8-1-2-8)19-5-3-17-4-6-19;;/h7-8,12,17H,1-6H2;2*1H/t12-;;/m0../s1 |
| InChIKey | GKXGGHYTFBHMBX-LTCKWSDVSA-N |
| XLogP | 4.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|