C13H19Cl4N3 — CID 171289222
1-[(R)-cyclopropyl-(2,6-dichloro-3-pyridinyl)methyl]piperazine;dihydrochloride (PubChem CID 171289222) has the molecular formula C13H19Cl4N3 and a molecular weight of 359.13 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(2,6-dichloro-3-pyridinyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopropyl-(2,6-dichloro-3-pyridinyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289222 |
| Molecular Formula | C13H19Cl4N3 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 1-[(R)-cyclopropyl-(2,6-dichloro-3-pyridinyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc([C@@H](C2CC2)N2CCNCC2)c(Cl)n1 |
| InChI | InChI=1S/C13H17Cl2N3.2ClH/c14-11-4-3-10(13(15)17-11)12(9-1-2-9)18-7-5-16-6-8-18;;/h3-4,9,12,16H,1-2,5-8H2;2*1H/t12-;;/m1../s1 |
| InChIKey | PPUWIWSVGLYDEU-CURYUGHLSA-N |
| XLogP | 3.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|