C14H20Cl3N3 — CID 171277578
1-[(1S)-2,2-dimethyl-1-(2,3,5-trichloro-4-pyridinyl)propyl]piperazine (PubChem CID 171277578) has the molecular formula C14H20Cl3N3 and a molecular weight of 336.69 g/mol. Its IUPAC name is 1-[(1S)-2,2-dimethyl-1-(2,3,5-trichloro-4-pyridinyl)propyl]piperazine.
| Compound Name | 1-[(1S)-2,2-dimethyl-1-(2,3,5-trichloro-4-pyridinyl)propyl]piperazine |
|---|---|
| PubChem CID | 171277578 |
| Molecular Formula | C14H20Cl3N3 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[(1S)-2,2-dimethyl-1-(2,3,5-trichloro-4-pyridinyl)propyl]piperazine |
| SMILES | CC(C)(C)[C@@H](c1c(Cl)cnc(Cl)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C14H20Cl3N3/c1-14(2,3)12(20-6-4-18-5-7-20)10-9(15)8-19-13(17)11(10)16/h8,12,18H,4-7H2,1-3H3/t12-/m1/s1 |
| InChIKey | OEWNWPOIBBEJGS-GFCCVEGCSA-N |
| XLogP | 4.03 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|