C15H23Cl5N2 — CID 171294626
1-[(1R)-2,2-dimethyl-1-(2,3,6-trichlorophenyl)propyl]piperazine;dihydrochloride (PubChem CID 171294626) has the molecular formula C15H23Cl5N2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 1-[(1R)-2,2-dimethyl-1-(2,3,6-trichlorophenyl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-2,2-dimethyl-1-(2,3,6-trichlorophenyl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171294626 |
| Molecular Formula | C15H23Cl5N2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 1-[(1R)-2,2-dimethyl-1-(2,3,6-trichlorophenyl)propyl]piperazine;dihydrochloride |
| SMILES | CC(C)(C)[C@H](c1c(Cl)ccc(Cl)c1Cl)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H21Cl3N2.2ClH/c1-15(2,3)14(20-8-6-19-7-9-20)12-10(16)4-5-11(17)13(12)18;;/h4-5,14,19H,6-9H2,1-3H3;2*1H/t14-;;/m0../s1 |
| InChIKey | CAHIZKREZKJLHY-UTLKBRERSA-N |
| XLogP | 5.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|