C12H14Cl4F4N2 — CID 171296366
1-[(1S)-1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride (PubChem CID 171296366) has the molecular formula C12H14Cl4F4N2 and a molecular weight of 404.06 g/mol. Its IUPAC name is 1-[(1S)-1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171296366 |
| Molecular Formula | C12H14Cl4F4N2 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 1-[(1S)-1-(2,3-dichloro-6-fluorophenyl)-2,2,2-trifluoroethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(Cl)c(Cl)c1[C@H](N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H12Cl2F4N2.2ClH/c13-7-1-2-8(15)9(10(7)14)11(12(16,17)18)20-5-3-19-4-6-20;;/h1-2,11,19H,3-6H2;2*1H/t11-;;/m0../s1 |
| InChIKey | ZLWQKKBDHFUCGG-IDMXKUIJSA-N |
| XLogP | 4.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|